C14H15N3O4S — CID 112523453
N-(1-methyl-2,3-dihydroindol-5-yl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 112523453) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is N-(1-methyl-2,3-dihydroindol-5-yl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(1-methyl-2,3-dihydroindol-5-yl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112523453 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(1-methyl-2,3-dihydroindol-5-yl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | CN1CCc2cc(NC(=O)c3ccc(S(N)(=O)=O)o3)ccc21 |
| InChI | InChI=1S/C14H15N3O4S/c1-17-7-6-9-8-10(2-3-11(9)17)16-14(18)12-4-5-13(21-12)22(15,19)20/h2-5,8H,6-7H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | MAVOIEHTCGHZSS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|