C16H23N3O3S — CID 110729349
N-(1-methyl-2,3-dihydroindol-5-yl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 110729349) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(1-methyl-2,3-dihydroindol-5-yl)-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 110729349 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CN1CCc2cc(NC(=O)C3CCN(S(C)(=O)=O)CC3)ccc21 |
| InChI | InChI=1S/C16H23N3O3S/c1-18-8-5-13-11-14(3-4-15(13)18)17-16(20)12-6-9-19(10-7-12)23(2,21)22/h3-4,11-12H,5-10H2,1-2H3,(H,17,20) |
| InChIKey | DKQYZWFBWLFOFO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|