C14H19N3O4S — CID 1081285
N-(4-carbamoylphenyl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 1081285) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 1081285 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(4-carbamoylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2ccc(C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C14H19N3O4S/c1-22(20,21)17-8-6-11(7-9-17)14(19)16-12-4-2-10(3-5-12)13(15)18/h2-5,11H,6-9H2,1H3,(H2,15,18)(H,16,19) |
| InChIKey | AHACIFRSOWZBTH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |