C17H23N3O6S — CID 55506118
[1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 55506118) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55506118 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(S(C)(=O)=O)CC1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H23N3O6S/c1-11(16(22)19-14-5-3-12(4-6-14)15(18)21)26-17(23)13-7-9-20(10-8-13)27(2,24)25/h3-6,11,13H,7-10H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | NBIQTZRNIMMQGY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |