C18H24N2O3 — CID 112523463
N-(1-methyl-2,3-dihydroindol-5-yl)-1,4-dioxaspiro[4.5]decane-8-carboxamide (PubChem CID 112523463) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(1-methyl-2,3-dihydroindol-5-yl)-1,4-dioxaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 112523463 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
| SMILES | CN1CCc2cc(NC(=O)C3CCC4(CC3)OCCO4)ccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-20-9-6-14-12-15(2-3-16(14)20)19-17(21)13-4-7-18(8-5-13)22-10-11-23-18/h2-3,12-13H,4-11H2,1H3,(H,19,21) |
| InChIKey | BCGWDZFNPXFFJY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|