C21H30N2O2 — CID 24637683
N-(1-acetyl-2,3-dihydroindol-5-yl)-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 24637683) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 24637683 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)C3CCC(C(C)(C)C)CC3)ccc21 |
| InChI | InChI=1S/C21H30N2O2/c1-14(24)23-12-11-16-13-18(9-10-19(16)23)22-20(25)15-5-7-17(8-6-15)21(2,3)4/h9-10,13,15,17H,5-8,11-12H2,1-4H3,(H,22,25) |
| InChIKey | QOHVRIXZIAETFQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |