C17H23NO3 — CID 112520650
N-(2,6-dimethylphenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide (PubChem CID 112520650) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 112520650 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-12-4-3-5-13(2)15(12)18-16(19)14-6-8-17(9-7-14)20-10-11-21-17/h3-5,14H,6-11H2,1-2H3,(H,18,19) |
| InChIKey | IFQFTORVWGYWLP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |