C15H17N3O4S — CID 112523527
N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 112523527) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112523527 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | CN1CCCc2cc(NC(=O)c3ccc(S(N)(=O)=O)o3)ccc21 |
| InChI | InChI=1S/C15H17N3O4S/c1-18-8-2-3-10-9-11(4-5-12(10)18)17-15(19)13-6-7-14(22-13)23(16,20)21/h4-7,9H,2-3,8H2,1H3,(H,17,19)(H2,16,20,21) |
| InChIKey | ZPARFYHNIDLWTK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|