C20H21N3O — CID 112523570
1-methyl-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)indole-5-carboxamide (PubChem CID 112523570) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-methyl-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)indole-5-carboxamide.
| Compound Name | 1-methyl-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)indole-5-carboxamide |
|---|---|
| PubChem CID | 112523570 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-methyl-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)indole-5-carboxamide |
| SMILES | CN1CCCc2cc(NC(=O)c3ccc4c(ccn4C)c3)ccc21 |
| InChI | InChI=1S/C20H21N3O/c1-22-10-3-4-14-13-17(6-8-19(14)22)21-20(24)16-5-7-18-15(12-16)9-11-23(18)2/h5-9,11-13H,3-4,10H2,1-2H3,(H,21,24) |
| InChIKey | RZDJXCHPOKLQJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|