C17H16N4O — CID 112523521
2-cyano-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)pyridine-4-carboxamide (PubChem CID 112523521) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-cyano-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)pyridine-4-carboxamide.
| Compound Name | 2-cyano-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112523521 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-cyano-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)pyridine-4-carboxamide |
| SMILES | CN1CCCc2cc(NC(=O)c3ccnc(C#N)c3)ccc21 |
| InChI | InChI=1S/C17H16N4O/c1-21-8-2-3-12-9-14(4-5-16(12)21)20-17(22)13-6-7-19-15(10-13)11-18/h4-7,9-10H,2-3,8H2,1H3,(H,20,22) |
| InChIKey | GWAPXAVSTUKVTC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|