C19H19N3O — CID 112523573
N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-indole-7-carboxamide (PubChem CID 112523573) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-indole-7-carboxamide.
| Compound Name | N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 112523573 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1H-indole-7-carboxamide |
| SMILES | CN1CCCc2cc(NC(=O)c3cccc4cc[nH]c34)ccc21 |
| InChI | InChI=1S/C19H19N3O/c1-22-11-3-5-14-12-15(7-8-17(14)22)21-19(23)16-6-2-4-13-9-10-20-18(13)16/h2,4,6-10,12,20H,3,5,11H2,1H3,(H,21,23) |
| InChIKey | MKVCXFKSUGRQTF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|