C19H15F3N2O — CID 59811456
N-(1-methylindol-5-yl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide (PubChem CID 59811456) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is N-(1-methylindol-5-yl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide.
| Compound Name | N-(1-methylindol-5-yl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 59811456 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(1-methylindol-5-yl)-4-[(E)-3,3,3-trifluoroprop-1-enyl]benzamide |
| SMILES | Cn1ccc2cc(NC(=O)c3ccc(/C=C/C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C19H15F3N2O/c1-24-11-9-15-12-16(6-7-17(15)24)23-18(25)14-4-2-13(3-5-14)8-10-19(20,21)22/h2-12H,1H3,(H,23,25)/b10-8+ |
| InChIKey | ZWBRPLBTNUZROY-CSKARUKUSA-N |
| XLogP | 5.01 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |