C16H16ClN3O — CID 45259292
1-(1-methylindol-5-yl)-3-phenylurea;hydrochloride (PubChem CID 45259292) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 1-(1-methylindol-5-yl)-3-phenylurea;hydrochloride.
| Compound Name | 1-(1-methylindol-5-yl)-3-phenylurea;hydrochloride |
|---|---|
| PubChem CID | 45259292 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(1-methylindol-5-yl)-3-phenylurea;hydrochloride |
| SMILES | Cl.Cn1ccc2cc(NC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C16H15N3O.ClH/c1-19-10-9-12-11-14(7-8-15(12)19)18-16(20)17-13-5-3-2-4-6-13;/h2-11H,1H3,(H2,17,18,20);1H |
| InChIKey | BEJJGNCQRGGHES-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |