C17H18IN5O — CID 67768152
1-(3-carbamimidoylphenyl)-3-(1-methylindol-5-yl)urea;hydroiodide (PubChem CID 67768152) has the molecular formula C17H18IN5O and a molecular weight of 435.27 g/mol. Its IUPAC name is 1-(3-carbamimidoylphenyl)-3-(1-methylindol-5-yl)urea;hydroiodide.
| Compound Name | 1-(3-carbamimidoylphenyl)-3-(1-methylindol-5-yl)urea;hydroiodide |
|---|---|
| PubChem CID | 67768152 |
| Molecular Formula | C17H18IN5O |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 1-(3-carbamimidoylphenyl)-3-(1-methylindol-5-yl)urea;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1cccc(NC(=O)Nc2ccc3c(ccn3C)c2)c1 |
| InChI | InChI=1S/C17H17N5O.HI/c1-22-8-7-11-9-14(5-6-15(11)22)21-17(23)20-13-4-2-3-12(10-13)16(18)19;/h2-10H,1H3,(H3,18,19)(H2,20,21,23);1H |
| InChIKey | KZSHNMFOQBNQLG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|