C21H21N5O — CID 139889780
1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(1-methylindol-5-yl)urea (PubChem CID 139889780) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(1-methylindol-5-yl)urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(1-methylindol-5-yl)urea |
|---|---|
| PubChem CID | 139889780 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(1-methylindol-5-yl)urea |
| SMILES | Cc1cc(C)n(-c2cccc(NC(=O)Nc3ccc4c(ccn4C)c3)c2)n1 |
| InChI | InChI=1S/C21H21N5O/c1-14-11-15(2)26(24-14)19-6-4-5-17(13-19)22-21(27)23-18-7-8-20-16(12-18)9-10-25(20)3/h4-13H,1-3H3,(H2,22,23,27) |
| InChIKey | XYZYLECOJFDJPN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |