C19H17N5OS — CID 139889793
1-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(1-methylindol-5-yl)urea (PubChem CID 139889793) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(1-methylindol-5-yl)urea.
| Compound Name | 1-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(1-methylindol-5-yl)urea |
|---|---|
| PubChem CID | 139889793 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(1-methylindol-5-yl)urea |
| SMILES | Cn1ccc2cc(NC(=O)Nc3cccc(-c4csc(N)n4)c3)ccc21 |
| InChI | InChI=1S/C19H17N5OS/c1-24-8-7-13-10-15(5-6-17(13)24)22-19(25)21-14-4-2-3-12(9-14)16-11-26-18(20)23-16/h2-11H,1H3,(H2,20,23)(H2,21,22,25) |
| InChIKey | VKAHOYKYYMDQPT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |