C11H8F3N3OS — CID 28865303
N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 28865303) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 28865303 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1nc(-c2cccc(NC(=O)C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C11H8F3N3OS/c12-11(13,14)9(18)16-7-3-1-2-6(4-7)8-5-19-10(15)17-8/h1-5H,(H2,15,17)(H,16,18) |
| InChIKey | AHJXDHKEVZFCGJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |