C17H15N3OS — CID 28865111
N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-phenylacetamide (PubChem CID 28865111) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-phenylacetamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 28865111 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-phenylacetamide |
| SMILES | Nc1nc(-c2cccc(NC(=O)Cc3ccccc3)c2)cs1 |
| InChI | InChI=1S/C17H15N3OS/c18-17-20-15(11-22-17)13-7-4-8-14(10-13)19-16(21)9-12-5-2-1-3-6-12/h1-8,10-11H,9H2,(H2,18,20)(H,19,21) |
| InChIKey | BDVQUYGGEAZRHB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |