C15H13N3S — CID 155427302
4-(3-anilinophenyl)-1,3-thiazol-2-amine (PubChem CID 155427302) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-(3-anilinophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-anilinophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155427302 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-(3-anilinophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc(Nc3ccccc3)c2)cs1 |
| InChI | InChI=1S/C15H13N3S/c16-15-18-14(10-19-15)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-10,17H,(H2,16,18) |
| InChIKey | BKKNJECJZDAAGL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |