C34H32N4S2 — CID 161234714
4-(2,6-dimethyl-4-phenylphenyl)-1,3-thiazol-2-amine (PubChem CID 161234714) has the molecular formula C34H32N4S2 and a molecular weight of 560.79 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-phenylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,6-dimethyl-4-phenylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 161234714 |
| Molecular Formula | C34H32N4S2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 4-(2,6-dimethyl-4-phenylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1csc(N)n1.Cc1cc(-c2ccccc2)cc(C)c1-c1csc(N)n1 |
| InChI | InChI=1S/2C17H16N2S/c2*1-11-8-14(13-6-4-3-5-7-13)9-12(2)16(11)15-10-20-17(18)19-15/h2*3-10H,1-2H3,(H2,18,19) |
| InChIKey | UZFKCEQRKIRYFK-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |