C38H40N4O2S2 — CID 159452230
4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine (PubChem CID 159452230) has the molecular formula C38H40N4O2S2 and a molecular weight of 648.90 g/mol. Its IUPAC name is 4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159452230 |
| Molecular Formula | C38H40N4O2S2 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)cc(Oc2cc(C)c(-c3csc(N)n3)c(C)c2)c1.Cc1cc(C)cc(Oc2cc(C)c(-c3csc(N)n3)c(C)c2)c1 |
| InChI | InChI=1S/2C19H20N2OS/c2*1-11-5-12(2)7-15(6-11)22-16-8-13(3)18(14(4)9-16)17-10-23-19(20)21-17/h2*5-10H,1-4H3,(H2,20,21) |
| InChIKey | LTNGYNULCTVBCA-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |