C12H14N2O2S — CID 15224835
4-(2,6-dimethoxy-4-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 15224835) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(2,6-dimethoxy-4-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,6-dimethoxy-4-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 15224835 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(2,6-dimethoxy-4-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(C)cc(OC)c1-c1csc(N)n1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7-4-9(15-2)11(10(5-7)16-3)8-6-17-12(13)14-8/h4-6H,1-3H3,(H2,13,14) |
| InChIKey | PQNOSQMGDYOCOO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |