About 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole
2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole (PubChem CID 116968062) has the molecular formula C12H12BrNOS
and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole |
| PubChem CID | 116968062 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole |
| SMILES | COc1cc(C)cc(C)c1-c1csc(Br)n1 |
| InChI | InChI=1S/C12H12BrNOS/c1-7-4-8(2)11(10(5-7)15-3)9-6-16-12(13)14-9/h4-6H,1-3H3 |
| InChIKey | CCHQUBKOGMFHIY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole?
The IUPAC name of 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole (CID 116968062) is 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole.
What is the SMILES notation for 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole?
The canonical SMILES for 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole is COc1cc(C)cc(C)c1-c1csc(Br)n1.
What is the InChIKey of 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole?
The InChIKey is CCHQUBKOGMFHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNOS/c1-7-4-8(2)11(10(5-7)15-3)9-6-16-12(13)14-9/h4-6H,1-3H3.
What are the key properties of 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole?
2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole has a molecular weight of 298.21 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole is sourced from PubChem (CID 116968062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).