C12H12BrNOS — CID 116968062
2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole (PubChem CID 116968062) has the molecular formula C12H12BrNOS and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole.
| Compound Name | 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116968062 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-bromo-4-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazole |
| SMILES | COc1cc(C)cc(C)c1-c1csc(Br)n1 |
| InChI | InChI=1S/C12H12BrNOS/c1-7-4-8(2)11(10(5-7)15-3)9-6-16-12(13)14-9/h4-6H,1-3H3 |
| InChIKey | CCHQUBKOGMFHIY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |