C13H15NO3S — CID 116867467
[4-(2,4-dimethoxy-6-methylphenyl)-1,3-thiazol-2-yl]methanol (PubChem CID 116867467) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is [4-(2,4-dimethoxy-6-methylphenyl)-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-(2,4-dimethoxy-6-methylphenyl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 116867467 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | [4-(2,4-dimethoxy-6-methylphenyl)-1,3-thiazol-2-yl]methanol |
| SMILES | COc1cc(C)c(-c2csc(CO)n2)c(OC)c1 |
| InChI | InChI=1S/C13H15NO3S/c1-8-4-9(16-2)5-11(17-3)13(8)10-7-18-12(6-15)14-10/h4-5,7,15H,6H2,1-3H3 |
| InChIKey | FRBRMCYKHCXAQO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |