C14H16BrNOS — CID 116970374
2-(bromomethyl)-4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-thiazole (PubChem CID 116970374) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-thiazole.
| Compound Name | 2-(bromomethyl)-4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116970374 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-(bromomethyl)-4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-thiazole |
| SMILES | COc1cc(C)c(-c2csc(CBr)n2)c(C)c1C |
| InChI | InChI=1S/C14H16BrNOS/c1-8-5-12(17-4)9(2)10(3)14(8)11-7-18-13(6-15)16-11/h5,7H,6H2,1-4H3 |
| InChIKey | SPPHHQHZIJXAFJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|