C12H15N3OS — CID 116892118
[2-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892118) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is [2-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892118 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [2-(2-methoxy-4,6-dimethylphenyl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | COc1cc(C)cc(C)c1-c1nc(NN)cs1 |
| InChI | InChI=1S/C12H15N3OS/c1-7-4-8(2)11(9(5-7)16-3)12-14-10(15-13)6-17-12/h4-6,15H,13H2,1-3H3 |
| InChIKey | APOTYKOHEBTGNC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|