C39H45BrN2O4S — CID 162014263
2-bromo-1-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]ethanone;4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine;ethanol (PubChem CID 162014263) has the molecular formula C39H45BrN2O4S and a molecular weight of 717.77 g/mol. Its IUPAC name is 2-bromo-1-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]ethanone;4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine;ethanol.
| Compound Name | 2-bromo-1-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]ethanone;4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine;ethanol |
|---|---|
| PubChem CID | 162014263 |
| Molecular Formula | C39H45BrN2O4S |
| Molecular Weight | 717.77 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | 2-bromo-1-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]ethanone;4-[4-(3,5-dimethylphenoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine;ethanol |
| SMILES | CCO.Cc1cc(C)cc(Oc2cc(C)c(-c3csc(N)n3)c(C)c2)c1.Cc1cc(C)cc(Oc2cc(C)c(C(=O)CBr)c(C)c2)c1 |
| InChI | InChI=1S/C19H20N2OS.C18H19BrO2.C2H6O/c1-11-5-12(2)7-15(6-11)22-16-8-13(3)18(14(4)9-16)17-10-23-19(20)21-17;1-11-5-12(2)7-15(6-11)21-16-8-13(3)18(14(4)9-16)17(20)10-19;1-2-3/h5-10H,1-4H3,(H2,20,21);5-9H,10H2,1-4H3;3H,2H2,1H3 |
| InChIKey | YTWUPZJDLUQYEG-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.77 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|