C12H10F3N3OS — CID 45156804
2,2,2-trifluoro-N-[3-(5-hydrazinylthiophen-3-yl)phenyl]acetamide (PubChem CID 45156804) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(5-hydrazinylthiophen-3-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(5-hydrazinylthiophen-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 45156804 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(5-hydrazinylthiophen-3-yl)phenyl]acetamide |
| SMILES | NNc1cc(-c2cccc(NC(=O)C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C12H10F3N3OS/c13-12(14,15)11(19)17-9-3-1-2-7(4-9)8-5-10(18-16)20-6-8/h1-6,18H,16H2,(H,17,19) |
| InChIKey | BMCVEGDRCLRYJJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|