C24H15F6N3OS — CID 122286137
1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea (PubChem CID 122286137) has the molecular formula C24H15F6N3OS and a molecular weight of 507.46 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 122286137 |
| Molecular Formula | C24H15F6N3OS |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2csc(-c3ccccc3)n2)c1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15F6N3OS/c25-23(26,27)16-10-17(24(28,29)30)12-19(11-16)32-22(34)31-18-8-4-7-15(9-18)20-13-35-21(33-20)14-5-2-1-3-6-14/h1-13H,(H2,31,32,34) |
| InChIKey | OMUZKHALHYEUSQ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |