C26H25N3OS — CID 121086466
1-(4-tert-butylphenyl)-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea (PubChem CID 121086466) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 121086466 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cccc(-c3csc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C26H25N3OS/c1-26(2,3)20-12-14-21(15-13-20)27-25(30)28-22-11-7-10-19(16-22)23-17-31-24(29-23)18-8-5-4-6-9-18/h4-17H,1-3H3,(H2,27,28,30) |
| InChIKey | AINZILUDGCSQKU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |