C22H15F2N3OS — CID 122286296
1-(3,5-difluorophenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea (PubChem CID 122286296) has the molecular formula C22H15F2N3OS and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 122286296 |
| Molecular Formula | C22H15F2N3OS |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2csc(-c3ccccc3)n2)cc1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H15F2N3OS/c23-16-10-17(24)12-19(11-16)26-22(28)25-18-8-6-14(7-9-18)20-13-29-21(27-20)15-4-2-1-3-5-15/h1-13H,(H2,25,26,28) |
| InChIKey | RAKFOAHAYYWHKD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |