C19H17ClN4O — CID 18475688
1-(1-methylindol-5-yl)-3-quinolin-4-ylurea;hydrochloride (PubChem CID 18475688) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-(1-methylindol-5-yl)-3-quinolin-4-ylurea;hydrochloride.
| Compound Name | 1-(1-methylindol-5-yl)-3-quinolin-4-ylurea;hydrochloride |
|---|---|
| PubChem CID | 18475688 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-(1-methylindol-5-yl)-3-quinolin-4-ylurea;hydrochloride |
| SMILES | Cl.Cn1ccc2cc(NC(=O)Nc3ccnc4ccccc34)ccc21 |
| InChI | InChI=1S/C19H16N4O.ClH/c1-23-11-9-13-12-14(6-7-18(13)23)21-19(24)22-17-8-10-20-16-5-3-2-4-15(16)17;/h2-12H,1H3,(H2,20,21,22,24);1H |
| InChIKey | RUDGYVDNUPZDER-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |