C24H23N5O — CID 54074413
1-[4-(N'-benzylcarbamimidoyl)phenyl]-3-(1-methylindol-5-yl)urea (PubChem CID 54074413) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[4-(N'-benzylcarbamimidoyl)phenyl]-3-(1-methylindol-5-yl)urea.
| Compound Name | 1-[4-(N'-benzylcarbamimidoyl)phenyl]-3-(1-methylindol-5-yl)urea |
|---|---|
| PubChem CID | 54074413 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[4-(N'-benzylcarbamimidoyl)phenyl]-3-(1-methylindol-5-yl)urea |
| SMILES | Cn1ccc2cc(NC(=O)Nc3ccc(/C(N)=N/Cc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C24H23N5O/c1-29-14-13-19-15-21(11-12-22(19)29)28-24(30)27-20-9-7-18(8-10-20)23(25)26-16-17-5-3-2-4-6-17/h2-15H,16H2,1H3,(H2,25,26)(H2,27,28,30) |
| InChIKey | MIRILSJTSQZMBT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|