C26H32Cl2N8O2 — CID 131876778
1-[4-(N'-ethylcarbamimidoyl)phenyl]-3-[4-[[4-(N'-ethylcarbamimidoyl)phenyl]carbamoylamino]phenyl]urea;dihydrochloride (PubChem CID 131876778) has the molecular formula C26H32Cl2N8O2 and a molecular weight of 559.50 g/mol. Its IUPAC name is 1-[4-(N'-ethylcarbamimidoyl)phenyl]-3-[4-[[4-(N'-ethylcarbamimidoyl)phenyl]carbamoylamino]phenyl]urea;dihydrochloride.
| Compound Name | 1-[4-(N'-ethylcarbamimidoyl)phenyl]-3-[4-[[4-(N'-ethylcarbamimidoyl)phenyl]carbamoylamino]phenyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 131876778 |
| Molecular Formula | C26H32Cl2N8O2 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 1-[4-(N'-ethylcarbamimidoyl)phenyl]-3-[4-[[4-(N'-ethylcarbamimidoyl)phenyl]carbamoylamino]phenyl]urea;dihydrochloride |
| SMILES | CC/N=C(\N)c1ccc(NC(=O)Nc2ccc(NC(=O)Nc3ccc(/C(N)=N/CC)cc3)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C26H30N8O2.2ClH/c1-3-29-23(27)17-5-9-19(10-6-17)31-25(35)33-21-13-15-22(16-14-21)34-26(36)32-20-11-7-18(8-12-20)24(28)30-4-2;;/h5-16H,3-4H2,1-2H3,(H2,27,29)(H2,28,30)(H2,31,33,35)(H2,32,34,36);2*1H |
| InChIKey | RDMXLWASDHYZQP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|