C19H21N5O2 — CID 91225385
1-(4-acetylphenyl)-3-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]urea (PubChem CID 91225385) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 91225385 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)Nc2ccc(/C(C)=N\N=C(C)N)cc2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-12(23-24-14(3)20)15-4-8-17(9-5-15)21-19(26)22-18-10-6-16(7-11-18)13(2)25/h4-11H,1-3H3,(H2,20,24)(H2,21,22,26)/b23-12- |
| InChIKey | BIUNFGOSQWMRLL-FMCGGJTJSA-N |
| XLogP | 3.63 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|