C17H18BrN5O — CID 91344269
1-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-bromophenyl)urea (PubChem CID 91344269) has the molecular formula C17H18BrN5O and a molecular weight of 388.27 g/mol. Its IUPAC name is 1-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-bromophenyl)urea.
| Compound Name | 1-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-bromophenyl)urea |
|---|---|
| PubChem CID | 91344269 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(4-bromophenyl)urea |
| SMILES | CC(N)=N/N=C(/C)c1ccc(NC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H18BrN5O/c1-11(22-23-12(2)19)13-3-7-15(8-4-13)20-17(24)21-16-9-5-14(18)6-10-16/h3-10H,1-2H3,(H2,19,23)(H2,20,21,24)/b22-11- |
| InChIKey | LUYHZAZGEYFTQZ-JJFYIABZSA-N |
| XLogP | 4.19 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|