C21H28N10O — CID 74389792
1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[N-(diaminomethylideneamino)-C-propylcarbonimidoyl]phenyl]urea (PubChem CID 74389792) has the molecular formula C21H28N10O and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[N-(diaminomethylideneamino)-C-propylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[N-(diaminomethylideneamino)-C-propylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 74389792 |
| Molecular Formula | C21H28N10O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[N-(diaminomethylideneamino)-C-propylcarbonimidoyl]phenyl]urea |
| SMILES | CCCC(=NN=C(N)N)c1ccc(NC(=O)Nc2ccc(C(C)=NN=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C21H28N10O/c1-3-4-18(29-31-20(24)25)15-7-11-17(12-8-15)27-21(32)26-16-9-5-14(6-10-16)13(2)28-30-19(22)23/h5-12H,3-4H2,1-2H3,(H4,22,23,30)(H4,24,25,31)(H2,26,27,32) |
| InChIKey | YTSWEZZQZIFNGG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|