C23H26N10O — CID 76562317
1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]naphthalen-1-yl]-3-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea (PubChem CID 76562317) has the molecular formula C23H26N10O and a molecular weight of 458.53 g/mol. Its IUPAC name is 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]naphthalen-1-yl]-3-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]naphthalen-1-yl]-3-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 76562317 |
| Molecular Formula | C23H26N10O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]naphthalen-1-yl]-3-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
| SMILES | CC(=NN=C(N)N)c1ccc(NC(=O)Nc2ccc(C(C)=NN=C(N)N)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H26N10O/c1-13(30-32-21(24)25)15-7-9-16(10-8-15)28-23(34)29-20-12-11-17(14(2)31-33-22(26)27)18-5-3-4-6-19(18)20/h3-12H,1-2H3,(H4,24,25,32)(H4,26,27,33)(H2,28,29,34) |
| InChIKey | WOQSMHYKRWCNNY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|