C24H26N10O — CID 123506865
1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[(Z)-N-(diaminomethylideneamino)-C-phenylcarbonimidoyl]phenyl]urea (PubChem CID 123506865) has the molecular formula C24H26N10O and a molecular weight of 470.54 g/mol. Its IUPAC name is 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[(Z)-N-(diaminomethylideneamino)-C-phenylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[(Z)-N-(diaminomethylideneamino)-C-phenylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 123506865 |
| Molecular Formula | C24H26N10O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 1-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[4-[(Z)-N-(diaminomethylideneamino)-C-phenylcarbonimidoyl]phenyl]urea |
| SMILES | C/C(=N/N=C(N)N)c1ccc(NC(=O)Nc2ccc(/C(=N\N=C(N)N)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H26N10O/c1-15(31-33-22(25)26)16-7-11-19(12-8-16)29-24(35)30-20-13-9-18(10-14-20)21(32-34-23(27)28)17-5-3-2-4-6-17/h2-14H,1H3,(H4,25,26,33)(H4,27,28,34)(H2,29,30,35)/b31-15-,32-21- |
| InChIKey | CVZQRAVQLNCKHP-PMWVQFDXSA-N |
| XLogP | 2.35 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|