C19H23N9O — CID 11165294
4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 11165294) has the molecular formula C19H23N9O and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11165294 |
| Molecular Formula | C19H23N9O |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | C/C(=N\N=C(N)N)c1ccc(C(=O)Nc2cccc(/C(C)=N/N=C(N)N)c2)cc1 |
| InChI | InChI=1S/C19H23N9O/c1-11(25-27-18(20)21)13-6-8-14(9-7-13)17(29)24-16-5-3-4-15(10-16)12(2)26-28-19(22)23/h3-10H,1-2H3,(H,24,29)(H4,20,21,27)(H4,22,23,28)/b25-11+,26-12+ |
| InChIKey | DXFOZAIDRSMEPV-KOZSXFMUSA-N |
| XLogP | 0.93 |
| TPSA | 182.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|