C27H30Cl2N8O — CID 86621649
N-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-[[6-(dimethylamino)quinolin-4-yl]amino]benzamide;dihydrochloride (PubChem CID 86621649) has the molecular formula C27H30Cl2N8O and a molecular weight of 553.50 g/mol. Its IUPAC name is N-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-[[6-(dimethylamino)quinolin-4-yl]amino]benzamide;dihydrochloride.
| Compound Name | N-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-[[6-(dimethylamino)quinolin-4-yl]amino]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 86621649 |
| Molecular Formula | C27H30Cl2N8O |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | N-[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-4-[[6-(dimethylamino)quinolin-4-yl]amino]benzamide;dihydrochloride |
| SMILES | C/C(=N/N=C(N)N)c1cccc(NC(=O)c2ccc(Nc3ccnc4ccc(N(C)C)cc34)cc2)c1.Cl.Cl |
| InChI | InChI=1S/C27H28N8O.2ClH/c1-17(33-34-27(28)29)19-5-4-6-21(15-19)32-26(36)18-7-9-20(10-8-18)31-25-13-14-30-24-12-11-22(35(2)3)16-23(24)25;;/h4-16H,1-3H3,(H,30,31)(H,32,36)(H4,28,29,34);2*1H/b33-17-;; |
| InChIKey | RMZINIQKZLWZSL-BIIXADDRSA-N |
| XLogP | 5.14 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|