C30H29ClN6O — CID 71659966
N-[4-[[6-(dimethylamino)quinolin-4-yl]amino]phenyl]-4-[(1-methylpyridin-1-ium-4-yl)amino]benzamide chloride (PubChem CID 71659966) has the molecular formula C30H29ClN6O and a molecular weight of 525.06 g/mol. Its IUPAC name is N-[4-[[6-(dimethylamino)quinolin-4-yl]amino]phenyl]-4-[(1-methylpyridin-1-ium-4-yl)amino]benzamide chloride.
| Compound Name | N-[4-[[6-(dimethylamino)quinolin-4-yl]amino]phenyl]-4-[(1-methylpyridin-1-ium-4-yl)amino]benzamide chloride |
|---|---|
| PubChem CID | 71659966 |
| Molecular Formula | C30H29ClN6O |
| Molecular Weight | 525.06 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[4-[[6-(dimethylamino)quinolin-4-yl]amino]phenyl]-4-[(1-methylpyridin-1-ium-4-yl)amino]benzamide chloride |
| SMILES | CN(C)c1ccc2nccc(Nc3ccc(NC(=O)c4ccc(Nc5cc[n+](C)cc5)cc4)cc3)c2c1.[Cl-] |
| InChI | InChI=1S/C30H28N6O.ClH/c1-35(2)26-12-13-28-27(20-26)29(14-17-31-28)33-23-8-10-24(11-9-23)34-30(37)21-4-6-22(7-5-21)32-25-15-18-36(3)19-16-25;/h4-20H,1-3H3,(H2,31,33,34,37);1H |
| InChIKey | OHQXLAWTNZELDO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|