C30H24N4O3 — CID 157189950
methyl 4-[4-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]anilino]quinoline-6-carboxylate (PubChem CID 157189950) has the molecular formula C30H24N4O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is methyl 4-[4-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]anilino]quinoline-6-carboxylate.
| Compound Name | methyl 4-[4-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]anilino]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 157189950 |
| Molecular Formula | C30H24N4O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | methyl 4-[4-[[4-(pyridin-4-ylmethyl)phenyl]carbamoyl]anilino]quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nccc(Nc3ccc(C(=O)Nc4ccc(Cc5ccncc5)cc4)cc3)c2c1 |
| InChI | InChI=1S/C30H24N4O3/c1-37-30(36)23-6-11-27-26(19-23)28(14-17-32-27)33-24-9-4-22(5-10-24)29(35)34-25-7-2-20(3-8-25)18-21-12-15-31-16-13-21/h2-17,19H,18H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | SWRGHRREBMLZTK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |