C18H13N3O2 — CID 176585499
methyl 4-[(6-isocyanoquinolin-4-yl)amino]benzoate (PubChem CID 176585499) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 4-[(6-isocyanoquinolin-4-yl)amino]benzoate.
| Compound Name | methyl 4-[(6-isocyanoquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 176585499 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 4-[(6-isocyanoquinolin-4-yl)amino]benzoate |
| SMILES | [C-]#[N+]c1ccc2nccc(Nc3ccc(C(=O)OC)cc3)c2c1 |
| InChI | InChI=1S/C18H13N3O2/c1-19-14-7-8-16-15(11-14)17(9-10-20-16)21-13-5-3-12(4-6-13)18(22)23-2/h3-11H,2H3,(H,20,21) |
| InChIKey | TZGFEQASXZXEOO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|