About methyl 3-isocyanobenzoate
methyl 3-isocyanobenzoate (PubChem CID 2759890) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is methyl 3-isocyanobenzoate.
Molecular Properties
| Compound Name | methyl 3-isocyanobenzoate |
| PubChem CID | 2759890 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | methyl 3-isocyanobenzoate |
| SMILES | [C-]#[N+]c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C9H7NO2/c1-10-8-5-3-4-7(6-8)9(11)12-2/h3-6H,2H3 |
| InChIKey | LWXRYLFWHIMKNP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-isocyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-isocyanobenzoate?
The IUPAC name of methyl 3-isocyanobenzoate (CID 2759890) is methyl 3-isocyanobenzoate.
What is the SMILES notation for methyl 3-isocyanobenzoate?
The canonical SMILES for methyl 3-isocyanobenzoate is [C-]#[N+]c1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-isocyanobenzoate?
The InChIKey is LWXRYLFWHIMKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-10-8-5-3-4-7(6-8)9(11)12-2/h3-6H,2H3.
What are the key properties of methyl 3-isocyanobenzoate?
methyl 3-isocyanobenzoate has a molecular weight of 161.16 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-isocyanobenzoate is sourced from PubChem (CID 2759890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).