C27H20N6O3 — CID 158257915
6-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide (PubChem CID 158257915) has the molecular formula C27H20N6O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 6-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158257915 |
| Molecular Formula | C27H20N6O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 6-[(6-nitroquinolin-4-yl)amino]-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)c1ccc(Nc2ccnc3ccc([N+](=O)[O-])cc23)nc1 |
| InChI | InChI=1S/C27H20N6O3/c34-27(31-21-4-1-18(2-5-21)15-19-9-12-28-13-10-19)20-3-8-26(30-17-20)32-25-11-14-29-24-7-6-22(33(35)36)16-23(24)25/h1-14,16-17H,15H2,(H,31,34)(H,29,30,32) |
| InChIKey | GXZNNYHZPFOJLV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|