C28H23N6O3+ — CID 67199735
4-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-[(6-nitroquinolin-4-yl)amino]phenyl]benzamide (PubChem CID 67199735) has the molecular formula C28H23N6O3+ and a molecular weight of 491.53 g/mol. Its IUPAC name is 4-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-[(6-nitroquinolin-4-yl)amino]phenyl]benzamide.
| Compound Name | 4-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-[(6-nitroquinolin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 67199735 |
| Molecular Formula | C28H23N6O3+ |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 4-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-[(6-nitroquinolin-4-yl)amino]phenyl]benzamide |
| SMILES | C[n+]1ccc(Nc2ccc(C(=O)Nc3ccc(Nc4ccnc5ccc([N+](=O)[O-])cc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H22N6O3/c1-33-16-13-23(14-17-33)30-20-4-2-19(3-5-20)28(35)32-22-8-6-21(7-9-22)31-27-12-15-29-26-11-10-24(34(36)37)18-25(26)27/h2-18H,1H3,(H2,29,31,32,35)/p+1 |
| InChIKey | NYNILJNJMWFAKG-UHFFFAOYSA-O |
| XLogP | 5.71 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|