C28H24N5O+ — CID 24858115
3-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-(quinolin-4-ylamino)phenyl]benzamide (PubChem CID 24858115) has the molecular formula C28H24N5O+ and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-(quinolin-4-ylamino)phenyl]benzamide.
| Compound Name | 3-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-(quinolin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 24858115 |
| Molecular Formula | C28H24N5O+ |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[(1-methylpyridin-1-ium-4-yl)amino]-N-[4-(quinolin-4-ylamino)phenyl]benzamide |
| SMILES | C[n+]1ccc(Nc2cccc(C(=O)Nc3ccc(Nc4ccnc5ccccc45)cc3)c2)cc1 |
| InChI | InChI=1S/C28H23N5O/c1-33-17-14-23(15-18-33)30-24-6-4-5-20(19-24)28(34)32-22-11-9-21(10-12-22)31-27-13-16-29-26-8-3-2-7-25(26)27/h2-19H,1H3,(H2,29,31,32,34)/p+1 |
| InChIKey | VOYLLADYILZQAL-UHFFFAOYSA-O |
| XLogP | 5.80 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|