C30H22N4O — CID 170005207
N-(4-anilinophenyl)-4-[(6-ethynylquinolin-4-yl)amino]benzamide (PubChem CID 170005207) has the molecular formula C30H22N4O and a molecular weight of 454.53 g/mol. Its IUPAC name is N-(4-anilinophenyl)-4-[(6-ethynylquinolin-4-yl)amino]benzamide.
| Compound Name | N-(4-anilinophenyl)-4-[(6-ethynylquinolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 170005207 |
| Molecular Formula | C30H22N4O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-(4-anilinophenyl)-4-[(6-ethynylquinolin-4-yl)amino]benzamide |
| SMILES | C#Cc1ccc2nccc(Nc3ccc(C(=O)Nc4ccc(Nc5ccccc5)cc4)cc3)c2c1 |
| InChI | InChI=1S/C30H22N4O/c1-2-21-8-17-28-27(20-21)29(18-19-31-28)33-25-11-9-22(10-12-25)30(35)34-26-15-13-24(14-16-26)32-23-6-4-3-5-7-23/h1,3-20,32H,(H,31,33)(H,34,35) |
| InChIKey | SRWILEJFHUUAFH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|