C29H21N5O — CID 163915964
3-[(6-ethynylquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide (PubChem CID 163915964) has the molecular formula C29H21N5O and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[(6-ethynylquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide.
| Compound Name | 3-[(6-ethynylquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 163915964 |
| Molecular Formula | C29H21N5O |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[(6-ethynylquinolin-4-yl)amino]-N-[4-(pyridin-4-ylamino)phenyl]benzamide |
| SMILES | C#Cc1ccc2nccc(Nc3cccc(C(=O)Nc4ccc(Nc5ccncc5)cc4)c3)c2c1 |
| InChI | InChI=1S/C29H21N5O/c1-2-20-6-11-27-26(18-20)28(14-17-31-27)33-25-5-3-4-21(19-25)29(35)34-23-9-7-22(8-10-23)32-24-12-15-30-16-13-24/h1,3-19H,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | QWGMKIXZAFSXMK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|